C21H26N2O — CID 24837494
5-[3-(dimethylamino)propyl]tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene-2-carboxamide (PubChem CID 24837494) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is 5-[3-(dimethylamino)propyl]tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene-2-carboxamide.
| Compound Name | 5-[3-(dimethylamino)propyl]tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene-2-carboxamide |
|---|---|
| PubChem CID | 24837494 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 5-[3-(dimethylamino)propyl]tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene-2-carboxamide |
| SMILES | CN(C)CCCc1ccc2c(c1)C(C(N)=O)c1ccccc1CC2 |
| InChI | InChI=1S/C21H26N2O/c1-23(2)13-5-6-15-9-10-17-12-11-16-7-3-4-8-18(16)20(21(22)24)19(17)14-15/h3-4,7-10,14,20H,5-6,11-13H2,1-2H3,(H2,22,24) |
| InChIKey | ZTBRZTUNCJEVHX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |