C22H32O — CID 24837518
(6aR,10aR)-6,6,9-trimethyl-3-(2-methylpentan-2-yl)-6a,7,8,10a-tetrahydrobenzo[c]chromene (PubChem CID 24837518) has the molecular formula C22H32O and a molecular weight of 312.50 g/mol. Its IUPAC name is (6aR,10aR)-6,6,9-trimethyl-3-(2-methylpentan-2-yl)-6a,7,8,10a-tetrahydrobenzo[c]chromene.
| Compound Name | (6aR,10aR)-6,6,9-trimethyl-3-(2-methylpentan-2-yl)-6a,7,8,10a-tetrahydrobenzo[c]chromene |
|---|---|
| PubChem CID | 24837518 |
| Molecular Formula | C22H32O |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | (6aR,10aR)-6,6,9-trimethyl-3-(2-methylpentan-2-yl)-6a,7,8,10a-tetrahydrobenzo[c]chromene |
| SMILES | CCCC(C)(C)c1ccc2c(c1)OC(C)(C)[C@@H]1CCC(C)=C[C@@H]21 |
| InChI | InChI=1S/C22H32O/c1-7-12-21(3,4)16-9-10-17-18-13-15(2)8-11-19(18)22(5,6)23-20(17)14-16/h9-10,13-14,18-19H,7-8,11-12H2,1-6H3/t18-,19+/m0/s1 |
| InChIKey | LCKMWFBVBATZPO-RBUKOAKNSA-N |
| XLogP | 6.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|