About [(E)-(3,3-dimethyl-1,4-dithian-2-ylidene)amino] N-methyl-N-(trichloromethylsulfanyl)carbamate
[(E)-(3,3-dimethyl-1,4-dithian-2-ylidene)amino] N-methyl-N-(trichloromethylsulfanyl)carbamate (PubChem CID 24837726) has the molecular formula C9H13Cl3N2O2S3
and a molecular weight of 383.78 g/mol. Its IUPAC name is [(E)-(3,3-dimethyl-1,4-dithian-2-ylidene)amino] N-methyl-N-(trichloromethylsulfanyl)carbamate.
Molecular Properties
| Compound Name | [(E)-(3,3-dimethyl-1,4-dithian-2-ylidene)amino] N-methyl-N-(trichloromethylsulfanyl)carbamate |
| PubChem CID | 24837726 |
| Molecular Formula | C9H13Cl3N2O2S3 |
| Molecular Weight | 383.78 g/mol |
| Exact Mass | 381.92 |
| IUPAC Name | [(E)-(3,3-dimethyl-1,4-dithian-2-ylidene)amino] N-methyl-N-(trichloromethylsulfanyl)carbamate |
| SMILES | CN(SC(Cl)(Cl)Cl)C(=O)O/N=C1/SCCSC1(C)C |
| InChI | InChI=1S/C9H13Cl3N2O2S3/c1-8(2)6(17-4-5-18-8)13-16-7(15)14(3)19-9(10,11)12/h4-5H2,1-3H3/b13-6+ |
| InChIKey | RAEHOEMDNHRNRN-AWNIVKPZSA-N |
| XLogP | 4.60 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.78 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-(3,3-dimethyl-1,4-dithian-2-ylidene)amino] N-methyl-N-(trichloromethylsulfanyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-(3,3-dimethyl-1,4-dithian-2-ylidene)amino] N-methyl-N-(trichloromethylsulfanyl)carbamate?
The IUPAC name of [(E)-(3,3-dimethyl-1,4-dithian-2-ylidene)amino] N-methyl-N-(trichloromethylsulfanyl)carbamate (CID 24837726) is [(E)-(3,3-dimethyl-1,4-dithian-2-ylidene)amino] N-methyl-N-(trichloromethylsulfanyl)carbamate.
What is the SMILES notation for [(E)-(3,3-dimethyl-1,4-dithian-2-ylidene)amino] N-methyl-N-(trichloromethylsulfanyl)carbamate?
The canonical SMILES for [(E)-(3,3-dimethyl-1,4-dithian-2-ylidene)amino] N-methyl-N-(trichloromethylsulfanyl)carbamate is CN(SC(Cl)(Cl)Cl)C(=O)O/N=C1/SCCSC1(C)C.
What is the InChIKey of [(E)-(3,3-dimethyl-1,4-dithian-2-ylidene)amino] N-methyl-N-(trichloromethylsulfanyl)carbamate?
The InChIKey is RAEHOEMDNHRNRN-AWNIVKPZSA-N. The full InChI is InChI=1S/C9H13Cl3N2O2S3/c1-8(2)6(17-4-5-18-8)13-16-7(15)14(3)19-9(10,11)12/h4-5H2,1-3H3/b13-6+.
What are the key properties of [(E)-(3,3-dimethyl-1,4-dithian-2-ylidene)amino] N-methyl-N-(trichloromethylsulfanyl)carbamate?
[(E)-(3,3-dimethyl-1,4-dithian-2-ylidene)amino] N-methyl-N-(trichloromethylsulfanyl)carbamate has a molecular weight of 383.78 g/mol, XLogP of 4.60, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-(3,3-dimethyl-1,4-dithian-2-ylidene)amino] N-methyl-N-(trichloromethylsulfanyl)carbamate is sourced from PubChem (CID 24837726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).