C12H21N5O5S3 — CID 24837947
methyl (1Z)-2-(dimethylamino)-N-[methyl-[methyl-[(Z)-1-methylsulfanylethylideneamino]oxycarbonylamino]sulfanylcarbamoyl]oxy-2-oxoethanimidothioate (PubChem CID 24837947) has the molecular formula C12H21N5O5S3 and a molecular weight of 411.53 g/mol. Its IUPAC name is methyl (1Z)-2-(dimethylamino)-N-[methyl-[methyl-[(Z)-1-methylsulfanylethylideneamino]oxycarbonylamino]sulfanylcarbamoyl]oxy-2-oxoethanimidothioate.
| Compound Name | methyl (1Z)-2-(dimethylamino)-N-[methyl-[methyl-[(Z)-1-methylsulfanylethylideneamino]oxycarbonylamino]sulfanylcarbamoyl]oxy-2-oxoethanimidothioate |
|---|---|
| PubChem CID | 24837947 |
| Molecular Formula | C12H21N5O5S3 |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | methyl (1Z)-2-(dimethylamino)-N-[methyl-[methyl-[(Z)-1-methylsulfanylethylideneamino]oxycarbonylamino]sulfanylcarbamoyl]oxy-2-oxoethanimidothioate |
| SMILES | CS/C(C)=N\OC(=O)N(C)SN(C)C(=O)O/N=C(\SC)C(=O)N(C)C |
| InChI | InChI=1S/C12H21N5O5S3/c1-8(23-6)13-21-11(19)16(4)25-17(5)12(20)22-14-9(24-7)10(18)15(2)3/h1-7H3/b13-8-,14-9- |
| InChIKey | GZPHDUSEYDKSHO-QKPPEBSVSA-N |
| XLogP | 2.15 |
| TPSA | 104.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|