About 1,1,2-trifluoroethene;hydrofluoride
1,1,2-trifluoroethene;hydrofluoride (PubChem CID 24838062) has the molecular formula C2H2F4
and a molecular weight of 102.03 g/mol. Its IUPAC name is 1,1,2-trifluoroethene;hydrofluoride.
Molecular Properties
| Compound Name | 1,1,2-trifluoroethene;hydrofluoride |
| PubChem CID | 24838062 |
| Molecular Formula | C2H2F4 |
| Molecular Weight | 102.03 g/mol |
| Exact Mass | 102.01 |
| IUPAC Name | 1,1,2-trifluoroethene;hydrofluoride |
| SMILES | F.FC=C(F)F |
| InChI | InChI=1S/C2HF3.FH/c3-1-2(4)5;/h1H;1H |
| InChIKey | XPIIYLUXKKHAPJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.03 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,1,2-trifluoroethene;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,2-trifluoroethene;hydrofluoride?
The IUPAC name of 1,1,2-trifluoroethene;hydrofluoride (CID 24838062) is 1,1,2-trifluoroethene;hydrofluoride.
What is the SMILES notation for 1,1,2-trifluoroethene;hydrofluoride?
The canonical SMILES for 1,1,2-trifluoroethene;hydrofluoride is F.FC=C(F)F.
What is the InChIKey of 1,1,2-trifluoroethene;hydrofluoride?
The InChIKey is XPIIYLUXKKHAPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2HF3.FH/c3-1-2(4)5;/h1H;1H.
What are the key properties of 1,1,2-trifluoroethene;hydrofluoride?
1,1,2-trifluoroethene;hydrofluoride has a molecular weight of 102.03 g/mol, XLogP of 1.85, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,2-trifluoroethene;hydrofluoride is sourced from PubChem (CID 24838062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).