About 4-butyl-1,4-dimethylpiperidine-2,6-dione
4-butyl-1,4-dimethylpiperidine-2,6-dione (PubChem CID 24838455) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is 4-butyl-1,4-dimethylpiperidine-2,6-dione.
Molecular Properties
| Compound Name | 4-butyl-1,4-dimethylpiperidine-2,6-dione |
| PubChem CID | 24838455 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 4-butyl-1,4-dimethylpiperidine-2,6-dione |
| SMILES | CCCCC1(C)CC(=O)N(C)C(=O)C1 |
| InChI | InChI=1S/C11H19NO2/c1-4-5-6-11(2)7-9(13)12(3)10(14)8-11/h4-8H2,1-3H3 |
| InChIKey | AUPHOIXJROTBFG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-butyl-1,4-dimethylpiperidine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-1,4-dimethylpiperidine-2,6-dione?
The IUPAC name of 4-butyl-1,4-dimethylpiperidine-2,6-dione (CID 24838455) is 4-butyl-1,4-dimethylpiperidine-2,6-dione.
What is the SMILES notation for 4-butyl-1,4-dimethylpiperidine-2,6-dione?
The canonical SMILES for 4-butyl-1,4-dimethylpiperidine-2,6-dione is CCCCC1(C)CC(=O)N(C)C(=O)C1.
What is the InChIKey of 4-butyl-1,4-dimethylpiperidine-2,6-dione?
The InChIKey is AUPHOIXJROTBFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2/c1-4-5-6-11(2)7-9(13)12(3)10(14)8-11/h4-8H2,1-3H3.
What are the key properties of 4-butyl-1,4-dimethylpiperidine-2,6-dione?
4-butyl-1,4-dimethylpiperidine-2,6-dione has a molecular weight of 197.28 g/mol, XLogP of 1.96, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-1,4-dimethylpiperidine-2,6-dione is sourced from PubChem (CID 24838455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).