C18H21ClN2O4 — CID 24838474
ethyl 2-[(5-amino-2-phenylmethoxybenzoyl)amino]acetate;hydrochloride (PubChem CID 24838474) has the molecular formula C18H21ClN2O4 and a molecular weight of 364.83 g/mol. Its IUPAC name is ethyl 2-[(5-amino-2-phenylmethoxybenzoyl)amino]acetate;hydrochloride.
| Compound Name | ethyl 2-[(5-amino-2-phenylmethoxybenzoyl)amino]acetate;hydrochloride |
|---|---|
| PubChem CID | 24838474 |
| Molecular Formula | C18H21ClN2O4 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | ethyl 2-[(5-amino-2-phenylmethoxybenzoyl)amino]acetate;hydrochloride |
| SMILES | CCOC(=O)CNC(=O)c1cc(N)ccc1OCc1ccccc1.Cl |
| InChI | InChI=1S/C18H20N2O4.ClH/c1-2-23-17(21)11-20-18(22)15-10-14(19)8-9-16(15)24-12-13-6-4-3-5-7-13;/h3-10H,2,11-12,19H2,1H3,(H,20,22);1H |
| InChIKey | ZAIDYRWUTBWNHT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|