C14H30I2N2 — CID 24838716
ethyl-[6-[ethyl(dimethyl)azaniumyl]hex-3-ynyl]-dimethylazanium diiodide (PubChem CID 24838716) has the molecular formula C14H30I2N2 and a molecular weight of 480.22 g/mol. Its IUPAC name is ethyl-[6-[ethyl(dimethyl)azaniumyl]hex-3-ynyl]-dimethylazanium diiodide.
| Compound Name | ethyl-[6-[ethyl(dimethyl)azaniumyl]hex-3-ynyl]-dimethylazanium diiodide |
|---|---|
| PubChem CID | 24838716 |
| Molecular Formula | C14H30I2N2 |
| Molecular Weight | 480.22 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | ethyl-[6-[ethyl(dimethyl)azaniumyl]hex-3-ynyl]-dimethylazanium diiodide |
| SMILES | CC[N+](C)(C)CCC#CCC[N+](C)(C)CC.[I-].[I-] |
| InChI | InChI=1S/C14H30N2.2HI/c1-7-15(3,4)13-11-9-10-12-14-16(5,6)8-2;;/h7-8,11-14H2,1-6H3;2*1H/q+2;;/p-2 |
| InChIKey | BWJUMZIUWSQZPN-UHFFFAOYSA-L |
| XLogP | -4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.22 |
| LogP ≤ 5 | -4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|