C17H13ClN2O7S — CID 24838873
[(Z)-[1-(1,3-benzodioxole-4-carbonyl)-7-chloro-2,3-dihydroquinolin-4-ylidene]amino] hydrogen sulfate (PubChem CID 24838873) has the molecular formula C17H13ClN2O7S and a molecular weight of 424.82 g/mol. Its IUPAC name is [(Z)-[1-(1,3-benzodioxole-4-carbonyl)-7-chloro-2,3-dihydroquinolin-4-ylidene]amino] hydrogen sulfate.
| Compound Name | [(Z)-[1-(1,3-benzodioxole-4-carbonyl)-7-chloro-2,3-dihydroquinolin-4-ylidene]amino] hydrogen sulfate |
|---|---|
| PubChem CID | 24838873 |
| Molecular Formula | C17H13ClN2O7S |
| Molecular Weight | 424.82 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | [(Z)-[1-(1,3-benzodioxole-4-carbonyl)-7-chloro-2,3-dihydroquinolin-4-ylidene]amino] hydrogen sulfate |
| SMILES | O=C(c1cccc2c1OCO2)N1CC/C(=N/OS(=O)(=O)O)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C17H13ClN2O7S/c18-10-4-5-11-13(19-27-28(22,23)24)6-7-20(14(11)8-10)17(21)12-2-1-3-15-16(12)26-9-25-15/h1-5,8H,6-7,9H2,(H,22,23,24)/b19-13- |
| InChIKey | CAMUTYRHSJIPJJ-UYRXBGFRSA-N |
| XLogP | 2.64 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.82 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|