About 10-(dimethylamino)-10,10a-dihydroindeno[1,2-b]quinolin-11-one
10-(dimethylamino)-10,10a-dihydroindeno[1,2-b]quinolin-11-one (PubChem CID 24839475) has the molecular formula C18H16N2O
and a molecular weight of 276.34 g/mol. Its IUPAC name is 10-(dimethylamino)-10,10a-dihydroindeno[1,2-b]quinolin-11-one.
Molecular Properties
| Compound Name | 10-(dimethylamino)-10,10a-dihydroindeno[1,2-b]quinolin-11-one |
| PubChem CID | 24839475 |
| Molecular Formula | C18H16N2O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 10-(dimethylamino)-10,10a-dihydroindeno[1,2-b]quinolin-11-one |
| SMILES | CN(C)C1c2ccccc2N=C2c3ccccc3C(=O)C21 |
| InChI | InChI=1S/C18H16N2O/c1-20(2)17-13-9-5-6-10-14(13)19-16-11-7-3-4-8-12(11)18(21)15(16)17/h3-10,15,17H,1-2H3 |
| InChIKey | CEDIPGNYQNUMMC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 10-(dimethylamino)-10,10a-dihydroindeno[1,2-b]quinolin-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(dimethylamino)-10,10a-dihydroindeno[1,2-b]quinolin-11-one?
The IUPAC name of 10-(dimethylamino)-10,10a-dihydroindeno[1,2-b]quinolin-11-one (CID 24839475) is 10-(dimethylamino)-10,10a-dihydroindeno[1,2-b]quinolin-11-one.
What is the SMILES notation for 10-(dimethylamino)-10,10a-dihydroindeno[1,2-b]quinolin-11-one?
The canonical SMILES for 10-(dimethylamino)-10,10a-dihydroindeno[1,2-b]quinolin-11-one is CN(C)C1c2ccccc2N=C2c3ccccc3C(=O)C21.
What is the InChIKey of 10-(dimethylamino)-10,10a-dihydroindeno[1,2-b]quinolin-11-one?
The InChIKey is CEDIPGNYQNUMMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O/c1-20(2)17-13-9-5-6-10-14(13)19-16-11-7-3-4-8-12(11)18(21)15(16)17/h3-10,15,17H,1-2H3.
What are the key properties of 10-(dimethylamino)-10,10a-dihydroindeno[1,2-b]quinolin-11-one?
10-(dimethylamino)-10,10a-dihydroindeno[1,2-b]quinolin-11-one has a molecular weight of 276.34 g/mol, XLogP of 3.24, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(dimethylamino)-10,10a-dihydroindeno[1,2-b]quinolin-11-one is sourced from PubChem (CID 24839475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).