About 10-(methylamino)-10,10a-dihydroindeno[1,2-b]quinolin-11-one
10-(methylamino)-10,10a-dihydroindeno[1,2-b]quinolin-11-one (PubChem CID 24839477) has the molecular formula C17H14N2O
and a molecular weight of 262.31 g/mol. Its IUPAC name is 10-(methylamino)-10,10a-dihydroindeno[1,2-b]quinolin-11-one.
Molecular Properties
| Compound Name | 10-(methylamino)-10,10a-dihydroindeno[1,2-b]quinolin-11-one |
| PubChem CID | 24839477 |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 10-(methylamino)-10,10a-dihydroindeno[1,2-b]quinolin-11-one |
| SMILES | CNC1c2ccccc2N=C2c3ccccc3C(=O)C21 |
| InChI | InChI=1S/C17H14N2O/c1-18-15-12-8-4-5-9-13(12)19-16-10-6-2-3-7-11(10)17(20)14(15)16/h2-9,14-15,18H,1H3 |
| InChIKey | OSABSQZDTUNYGJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 10-(methylamino)-10,10a-dihydroindeno[1,2-b]quinolin-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(methylamino)-10,10a-dihydroindeno[1,2-b]quinolin-11-one?
The IUPAC name of 10-(methylamino)-10,10a-dihydroindeno[1,2-b]quinolin-11-one (CID 24839477) is 10-(methylamino)-10,10a-dihydroindeno[1,2-b]quinolin-11-one.
What is the SMILES notation for 10-(methylamino)-10,10a-dihydroindeno[1,2-b]quinolin-11-one?
The canonical SMILES for 10-(methylamino)-10,10a-dihydroindeno[1,2-b]quinolin-11-one is CNC1c2ccccc2N=C2c3ccccc3C(=O)C21.
What is the InChIKey of 10-(methylamino)-10,10a-dihydroindeno[1,2-b]quinolin-11-one?
The InChIKey is OSABSQZDTUNYGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O/c1-18-15-12-8-4-5-9-13(12)19-16-10-6-2-3-7-11(10)17(20)14(15)16/h2-9,14-15,18H,1H3.
What are the key properties of 10-(methylamino)-10,10a-dihydroindeno[1,2-b]quinolin-11-one?
10-(methylamino)-10,10a-dihydroindeno[1,2-b]quinolin-11-one has a molecular weight of 262.31 g/mol, XLogP of 2.89, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(methylamino)-10,10a-dihydroindeno[1,2-b]quinolin-11-one is sourced from PubChem (CID 24839477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).