About 5-methyl-N'-propan-2-yl-1,2-oxazole-3-carbohydrazide
5-methyl-N'-propan-2-yl-1,2-oxazole-3-carbohydrazide (PubChem CID 24839857) has the molecular formula C8H13N3O2
and a molecular weight of 183.21 g/mol. Its IUPAC name is 5-methyl-N'-propan-2-yl-1,2-oxazole-3-carbohydrazide.
Molecular Properties
| Compound Name | 5-methyl-N'-propan-2-yl-1,2-oxazole-3-carbohydrazide |
| PubChem CID | 24839857 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 5-methyl-N'-propan-2-yl-1,2-oxazole-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(C)C)no1 |
| InChI | InChI=1S/C8H13N3O2/c1-5(2)9-10-8(12)7-4-6(3)13-11-7/h4-5,9H,1-3H3,(H,10,12) |
| InChIKey | DAQQAHUPISFSRS-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-N'-propan-2-yl-1,2-oxazole-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N'-propan-2-yl-1,2-oxazole-3-carbohydrazide?
The IUPAC name of 5-methyl-N'-propan-2-yl-1,2-oxazole-3-carbohydrazide (CID 24839857) is 5-methyl-N'-propan-2-yl-1,2-oxazole-3-carbohydrazide.
What is the SMILES notation for 5-methyl-N'-propan-2-yl-1,2-oxazole-3-carbohydrazide?
The canonical SMILES for 5-methyl-N'-propan-2-yl-1,2-oxazole-3-carbohydrazide is Cc1cc(C(=O)NNC(C)C)no1.
What is the InChIKey of 5-methyl-N'-propan-2-yl-1,2-oxazole-3-carbohydrazide?
The InChIKey is DAQQAHUPISFSRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O2/c1-5(2)9-10-8(12)7-4-6(3)13-11-7/h4-5,9H,1-3H3,(H,10,12).
What are the key properties of 5-methyl-N'-propan-2-yl-1,2-oxazole-3-carbohydrazide?
5-methyl-N'-propan-2-yl-1,2-oxazole-3-carbohydrazide has a molecular weight of 183.21 g/mol, XLogP of 0.63, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N'-propan-2-yl-1,2-oxazole-3-carbohydrazide is sourced from PubChem (CID 24839857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).