C14H18Cl2N4O10S — CID 24839868
2-(2-chloroethyl)-2-(3-chloropropyl)-1,2-oxazolidin-2-ium;2,4,6-trinitrobenzenesulfonate (PubChem CID 24839868) has the molecular formula C14H18Cl2N4O10S and a molecular weight of 505.29 g/mol. Its IUPAC name is 2-(2-chloroethyl)-2-(3-chloropropyl)-1,2-oxazolidin-2-ium;2,4,6-trinitrobenzenesulfonate.
| Compound Name | 2-(2-chloroethyl)-2-(3-chloropropyl)-1,2-oxazolidin-2-ium;2,4,6-trinitrobenzenesulfonate |
|---|---|
| PubChem CID | 24839868 |
| Molecular Formula | C14H18Cl2N4O10S |
| Molecular Weight | 505.29 g/mol |
| Exact Mass | 504.01 |
| IUPAC Name | 2-(2-chloroethyl)-2-(3-chloropropyl)-1,2-oxazolidin-2-ium;2,4,6-trinitrobenzenesulfonate |
| SMILES | ClCCC[N+]1(CCCl)CCCO1.O=[N+]([O-])c1cc([N+](=O)[O-])c(S(=O)(=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H16Cl2NO.C6H3N3O9S/c9-3-1-5-11(7-4-10)6-2-8-12-11;10-7(11)3-1-4(8(12)13)6(19(16,17)18)5(2-3)9(14)15/h1-8H2;1-2H,(H,16,17,18)/q+1;/p-1 |
| InChIKey | ZIMHUPSISKMULR-UHFFFAOYSA-M |
| XLogP | 2.32 |
| TPSA | 195.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|