C8H13HgN2O5 — CID 24840018
[2-methoxy-3-(2,4,6-trioxo-1,3-diazinan-1-yl)propyl]mercury;hydrate (PubChem CID 24840018) has the molecular formula C8H13HgN2O5 and a molecular weight of 417.79 g/mol. Its IUPAC name is [2-methoxy-3-(2,4,6-trioxo-1,3-diazinan-1-yl)propyl]mercury;hydrate.
| Compound Name | [2-methoxy-3-(2,4,6-trioxo-1,3-diazinan-1-yl)propyl]mercury;hydrate |
|---|---|
| PubChem CID | 24840018 |
| Molecular Formula | C8H13HgN2O5 |
| Molecular Weight | 417.79 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | [2-methoxy-3-(2,4,6-trioxo-1,3-diazinan-1-yl)propyl]mercury;hydrate |
| SMILES | COC(C[Hg])CN1C(=O)CC(=O)NC1=O.O |
| InChI | InChI=1S/C8H11N2O4.Hg.H2O/c1-5(14-2)4-10-7(12)3-6(11)9-8(10)13;;/h5H,1,3-4H2,2H3,(H,9,11,13);;1H2 |
| InChIKey | IMUNNVWOSQFSPP-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.79 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|