About 2-morpholin-4-yl-N-(2,4,4-trimethylpentan-2-yl)acetamide;hydrochloride
2-morpholin-4-yl-N-(2,4,4-trimethylpentan-2-yl)acetamide;hydrochloride (PubChem CID 24840192) has the molecular formula C14H29ClN2O2
and a molecular weight of 292.85 g/mol. Its IUPAC name is 2-morpholin-4-yl-N-(2,4,4-trimethylpentan-2-yl)acetamide;hydrochloride.
Molecular Properties
| Compound Name | 2-morpholin-4-yl-N-(2,4,4-trimethylpentan-2-yl)acetamide;hydrochloride |
| PubChem CID | 24840192 |
| Molecular Formula | C14H29ClN2O2 |
| Molecular Weight | 292.85 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 2-morpholin-4-yl-N-(2,4,4-trimethylpentan-2-yl)acetamide;hydrochloride |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)CN1CCOCC1.Cl |
| InChI | InChI=1S/C14H28N2O2.ClH/c1-13(2,3)11-14(4,5)15-12(17)10-16-6-8-18-9-7-16;/h6-11H2,1-5H3,(H,15,17);1H |
| InChIKey | XFFJCRZLFZPQBW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.85 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-morpholin-4-yl-N-(2,4,4-trimethylpentan-2-yl)acetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-yl-N-(2,4,4-trimethylpentan-2-yl)acetamide;hydrochloride?
The IUPAC name of 2-morpholin-4-yl-N-(2,4,4-trimethylpentan-2-yl)acetamide;hydrochloride (CID 24840192) is 2-morpholin-4-yl-N-(2,4,4-trimethylpentan-2-yl)acetamide;hydrochloride.
What is the SMILES notation for 2-morpholin-4-yl-N-(2,4,4-trimethylpentan-2-yl)acetamide;hydrochloride?
The canonical SMILES for 2-morpholin-4-yl-N-(2,4,4-trimethylpentan-2-yl)acetamide;hydrochloride is CC(C)(C)CC(C)(C)NC(=O)CN1CCOCC1.Cl.
What is the InChIKey of 2-morpholin-4-yl-N-(2,4,4-trimethylpentan-2-yl)acetamide;hydrochloride?
The InChIKey is XFFJCRZLFZPQBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2O2.ClH/c1-13(2,3)11-14(4,5)15-12(17)10-16-6-8-18-9-7-16;/h6-11H2,1-5H3,(H,15,17);1H.
What are the key properties of 2-morpholin-4-yl-N-(2,4,4-trimethylpentan-2-yl)acetamide;hydrochloride?
2-morpholin-4-yl-N-(2,4,4-trimethylpentan-2-yl)acetamide;hydrochloride has a molecular weight of 292.85 g/mol, XLogP of 2.07, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-yl-N-(2,4,4-trimethylpentan-2-yl)acetamide;hydrochloride is sourced from PubChem (CID 24840192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).