C22H33ClN2O — CID 24840587
(E,E)-1-(4-chlorophenyl)-N-(2-piperidin-1-ylethoxy)non-1-en-3-imine (PubChem CID 24840587) has the molecular formula C22H33ClN2O and a molecular weight of 376.97 g/mol. Its IUPAC name is (E,E)-1-(4-chlorophenyl)-N-(2-piperidin-1-ylethoxy)non-1-en-3-imine.
| Compound Name | (E,E)-1-(4-chlorophenyl)-N-(2-piperidin-1-ylethoxy)non-1-en-3-imine |
|---|---|
| PubChem CID | 24840587 |
| Molecular Formula | C22H33ClN2O |
| Molecular Weight | 376.97 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | (E,E)-1-(4-chlorophenyl)-N-(2-piperidin-1-ylethoxy)non-1-en-3-imine |
| SMILES | CCCCCCC(/C=C/c1ccc(Cl)cc1)=N\OCCN1CCCCC1 |
| InChI | InChI=1S/C22H33ClN2O/c1-2-3-4-6-9-22(15-12-20-10-13-21(23)14-11-20)24-26-19-18-25-16-7-5-8-17-25/h10-15H,2-9,16-19H2,1H3/b15-12+,24-22+ |
| InChIKey | APUXJVWUDISVHN-GRXRNDOGSA-N |
| XLogP | 6.18 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.97 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|