C22H26N6O8 — CID 24840762
N-ethyl-5-[1-[4-(2-methylpropyl)phenyl]ethyl]-1,3,4-oxadiazol-2-amine;2,4,6-trinitrophenol (PubChem CID 24840762) has the molecular formula C22H26N6O8 and a molecular weight of 502.48 g/mol. Its IUPAC name is N-ethyl-5-[1-[4-(2-methylpropyl)phenyl]ethyl]-1,3,4-oxadiazol-2-amine;2,4,6-trinitrophenol.
| Compound Name | N-ethyl-5-[1-[4-(2-methylpropyl)phenyl]ethyl]-1,3,4-oxadiazol-2-amine;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 24840762 |
| Molecular Formula | C22H26N6O8 |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | N-ethyl-5-[1-[4-(2-methylpropyl)phenyl]ethyl]-1,3,4-oxadiazol-2-amine;2,4,6-trinitrophenol |
| SMILES | CCNc1nnc(C(C)c2ccc(CC(C)C)cc2)o1.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H23N3O.C6H3N3O7/c1-5-17-16-19-18-15(20-16)12(4)14-8-6-13(7-9-14)10-11(2)3;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h6-9,11-12H,5,10H2,1-4H3,(H,17,19);1-2,10H |
| InChIKey | RSIMUFSNOPEWTM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 200.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|