C24H26BrN3 — CID 24841152
3-N,3-N,8-N,8-N,5-pentamethyl-6-phenylphenanthridin-5-ium-3,8-diamine bromide (PubChem CID 24841152) has the molecular formula C24H26BrN3 and a molecular weight of 436.40 g/mol. Its IUPAC name is 3-N,3-N,8-N,8-N,5-pentamethyl-6-phenylphenanthridin-5-ium-3,8-diamine bromide.
| Compound Name | 3-N,3-N,8-N,8-N,5-pentamethyl-6-phenylphenanthridin-5-ium-3,8-diamine bromide |
|---|---|
| PubChem CID | 24841152 |
| Molecular Formula | C24H26BrN3 |
| Molecular Weight | 436.40 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 3-N,3-N,8-N,8-N,5-pentamethyl-6-phenylphenanthridin-5-ium-3,8-diamine bromide |
| SMILES | CN(C)c1ccc2c(c1)c(-c1ccccc1)[n+](C)c1cc(N(C)C)ccc21.[Br-] |
| InChI | InChI=1S/C24H26N3.BrH/c1-25(2)18-11-13-20-21-14-12-19(26(3)4)16-23(21)27(5)24(22(20)15-18)17-9-7-6-8-10-17;/h6-16H,1-5H3;1H/q+1;/p-1 |
| InChIKey | BJFSJYBLRPLJDF-UHFFFAOYSA-M |
| XLogP | 1.62 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|