About 2-(4-butyl-4-ethyl-2,6-dioxopiperidin-1-yl)-N,N-dimethylacetamide
2-(4-butyl-4-ethyl-2,6-dioxopiperidin-1-yl)-N,N-dimethylacetamide (PubChem CID 24842440) has the molecular formula C15H26N2O3
and a molecular weight of 282.38 g/mol. Its IUPAC name is 2-(4-butyl-4-ethyl-2,6-dioxopiperidin-1-yl)-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-(4-butyl-4-ethyl-2,6-dioxopiperidin-1-yl)-N,N-dimethylacetamide |
| PubChem CID | 24842440 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 2-(4-butyl-4-ethyl-2,6-dioxopiperidin-1-yl)-N,N-dimethylacetamide |
| SMILES | CCCCC1(CC)CC(=O)N(CC(=O)N(C)C)C(=O)C1 |
| InChI | InChI=1S/C15H26N2O3/c1-5-7-8-15(6-2)9-12(18)17(13(19)10-15)11-14(20)16(3)4/h5-11H2,1-4H3 |
| InChIKey | FKZLHOMTJVMOGE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-butyl-4-ethyl-2,6-dioxopiperidin-1-yl)-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-butyl-4-ethyl-2,6-dioxopiperidin-1-yl)-N,N-dimethylacetamide?
The IUPAC name of 2-(4-butyl-4-ethyl-2,6-dioxopiperidin-1-yl)-N,N-dimethylacetamide (CID 24842440) is 2-(4-butyl-4-ethyl-2,6-dioxopiperidin-1-yl)-N,N-dimethylacetamide.
What is the SMILES notation for 2-(4-butyl-4-ethyl-2,6-dioxopiperidin-1-yl)-N,N-dimethylacetamide?
The canonical SMILES for 2-(4-butyl-4-ethyl-2,6-dioxopiperidin-1-yl)-N,N-dimethylacetamide is CCCCC1(CC)CC(=O)N(CC(=O)N(C)C)C(=O)C1.
What is the InChIKey of 2-(4-butyl-4-ethyl-2,6-dioxopiperidin-1-yl)-N,N-dimethylacetamide?
The InChIKey is FKZLHOMTJVMOGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2O3/c1-5-7-8-15(6-2)9-12(18)17(13(19)10-15)11-14(20)16(3)4/h5-11H2,1-4H3.
What are the key properties of 2-(4-butyl-4-ethyl-2,6-dioxopiperidin-1-yl)-N,N-dimethylacetamide?
2-(4-butyl-4-ethyl-2,6-dioxopiperidin-1-yl)-N,N-dimethylacetamide has a molecular weight of 282.38 g/mol, XLogP of 1.81, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-butyl-4-ethyl-2,6-dioxopiperidin-1-yl)-N,N-dimethylacetamide is sourced from PubChem (CID 24842440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).