About 2-piperidin-1-yl-N-(2,4,4-trimethylpentan-2-yl)acetamide;hydrochloride
2-piperidin-1-yl-N-(2,4,4-trimethylpentan-2-yl)acetamide;hydrochloride (PubChem CID 24842493) has the molecular formula C15H31ClN2O
and a molecular weight of 290.88 g/mol. Its IUPAC name is 2-piperidin-1-yl-N-(2,4,4-trimethylpentan-2-yl)acetamide;hydrochloride.
Molecular Properties
| Compound Name | 2-piperidin-1-yl-N-(2,4,4-trimethylpentan-2-yl)acetamide;hydrochloride |
| PubChem CID | 24842493 |
| Molecular Formula | C15H31ClN2O |
| Molecular Weight | 290.88 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 2-piperidin-1-yl-N-(2,4,4-trimethylpentan-2-yl)acetamide;hydrochloride |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)CN1CCCCC1.Cl |
| InChI | InChI=1S/C15H30N2O.ClH/c1-14(2,3)12-15(4,5)16-13(18)11-17-9-7-6-8-10-17;/h6-12H2,1-5H3,(H,16,18);1H |
| InChIKey | HSQVMPOXXITWRP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.88 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-piperidin-1-yl-N-(2,4,4-trimethylpentan-2-yl)acetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-yl-N-(2,4,4-trimethylpentan-2-yl)acetamide;hydrochloride?
The IUPAC name of 2-piperidin-1-yl-N-(2,4,4-trimethylpentan-2-yl)acetamide;hydrochloride (CID 24842493) is 2-piperidin-1-yl-N-(2,4,4-trimethylpentan-2-yl)acetamide;hydrochloride.
What is the SMILES notation for 2-piperidin-1-yl-N-(2,4,4-trimethylpentan-2-yl)acetamide;hydrochloride?
The canonical SMILES for 2-piperidin-1-yl-N-(2,4,4-trimethylpentan-2-yl)acetamide;hydrochloride is CC(C)(C)CC(C)(C)NC(=O)CN1CCCCC1.Cl.
What is the InChIKey of 2-piperidin-1-yl-N-(2,4,4-trimethylpentan-2-yl)acetamide;hydrochloride?
The InChIKey is HSQVMPOXXITWRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2O.ClH/c1-14(2,3)12-15(4,5)16-13(18)11-17-9-7-6-8-10-17;/h6-12H2,1-5H3,(H,16,18);1H.
What are the key properties of 2-piperidin-1-yl-N-(2,4,4-trimethylpentan-2-yl)acetamide;hydrochloride?
2-piperidin-1-yl-N-(2,4,4-trimethylpentan-2-yl)acetamide;hydrochloride has a molecular weight of 290.88 g/mol, XLogP of 3.23, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-yl-N-(2,4,4-trimethylpentan-2-yl)acetamide;hydrochloride is sourced from PubChem (CID 24842493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).