C17H32N4O2 — CID 24842495
2-piperidin-1-yl-N-[3-[(2-piperidin-1-ylacetyl)amino]propyl]acetamide (PubChem CID 24842495) has the molecular formula C17H32N4O2 and a molecular weight of 324.47 g/mol. Its IUPAC name is 2-piperidin-1-yl-N-[3-[(2-piperidin-1-ylacetyl)amino]propyl]acetamide.
| Compound Name | 2-piperidin-1-yl-N-[3-[(2-piperidin-1-ylacetyl)amino]propyl]acetamide |
|---|---|
| PubChem CID | 24842495 |
| Molecular Formula | C17H32N4O2 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | 2-piperidin-1-yl-N-[3-[(2-piperidin-1-ylacetyl)amino]propyl]acetamide |
| SMILES | O=C(CN1CCCCC1)NCCCNC(=O)CN1CCCCC1 |
| InChI | InChI=1S/C17H32N4O2/c22-16(14-20-10-3-1-4-11-20)18-8-7-9-19-17(23)15-21-12-5-2-6-13-21/h1-15H2,(H,18,22)(H,19,23) |
| InChIKey | JVSJZCAMAVQCIE-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|