About 1-[2-[(3,5-dimethylphenyl)methoxy]-3-piperidin-1-ylpropyl]piperidine;dihydrochloride
1-[2-[(3,5-dimethylphenyl)methoxy]-3-piperidin-1-ylpropyl]piperidine;dihydrochloride (PubChem CID 24842661) has the molecular formula C22H38Cl2N2O
and a molecular weight of 417.47 g/mol. Its IUPAC name is 1-[2-[(3,5-dimethylphenyl)methoxy]-3-piperidin-1-ylpropyl]piperidine;dihydrochloride.
Molecular Properties
| Compound Name | 1-[2-[(3,5-dimethylphenyl)methoxy]-3-piperidin-1-ylpropyl]piperidine;dihydrochloride |
| PubChem CID | 24842661 |
| Molecular Formula | C22H38Cl2N2O |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 1-[2-[(3,5-dimethylphenyl)methoxy]-3-piperidin-1-ylpropyl]piperidine;dihydrochloride |
| SMILES | Cc1cc(C)cc(COC(CN2CCCCC2)CN2CCCCC2)c1.Cl.Cl |
| InChI | InChI=1S/C22H36N2O.2ClH/c1-19-13-20(2)15-21(14-19)18-25-22(16-23-9-5-3-6-10-23)17-24-11-7-4-8-12-24;;/h13-15,22H,3-12,16-18H2,1-2H3;2*1H |
| InChIKey | XLNUGBRZVFMNTI-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-[(3,5-dimethylphenyl)methoxy]-3-piperidin-1-ylpropyl]piperidine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(3,5-dimethylphenyl)methoxy]-3-piperidin-1-ylpropyl]piperidine;dihydrochloride?
The IUPAC name of 1-[2-[(3,5-dimethylphenyl)methoxy]-3-piperidin-1-ylpropyl]piperidine;dihydrochloride (CID 24842661) is 1-[2-[(3,5-dimethylphenyl)methoxy]-3-piperidin-1-ylpropyl]piperidine;dihydrochloride.
What is the SMILES notation for 1-[2-[(3,5-dimethylphenyl)methoxy]-3-piperidin-1-ylpropyl]piperidine;dihydrochloride?
The canonical SMILES for 1-[2-[(3,5-dimethylphenyl)methoxy]-3-piperidin-1-ylpropyl]piperidine;dihydrochloride is Cc1cc(C)cc(COC(CN2CCCCC2)CN2CCCCC2)c1.Cl.Cl.
What is the InChIKey of 1-[2-[(3,5-dimethylphenyl)methoxy]-3-piperidin-1-ylpropyl]piperidine;dihydrochloride?
The InChIKey is XLNUGBRZVFMNTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H36N2O.2ClH/c1-19-13-20(2)15-21(14-19)18-25-22(16-23-9-5-3-6-10-23)17-24-11-7-4-8-12-24;;/h13-15,22H,3-12,16-18H2,1-2H3;2*1H.
What are the key properties of 1-[2-[(3,5-dimethylphenyl)methoxy]-3-piperidin-1-ylpropyl]piperidine;dihydrochloride?
1-[2-[(3,5-dimethylphenyl)methoxy]-3-piperidin-1-ylpropyl]piperidine;dihydrochloride has a molecular weight of 417.47 g/mol, XLogP of 5.00, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(3,5-dimethylphenyl)methoxy]-3-piperidin-1-ylpropyl]piperidine;dihydrochloride is sourced from PubChem (CID 24842661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).