About N',N'-diethyl-N-[2-[(Z)-2-(5-nitrofuran-2-yl)ethenyl]quinolin-8-yl]propane-1,3-diamine
N',N'-diethyl-N-[2-[(Z)-2-(5-nitrofuran-2-yl)ethenyl]quinolin-8-yl]propane-1,3-diamine (PubChem CID 24843304) has the molecular formula C22H26N4O3
and a molecular weight of 394.48 g/mol. Its IUPAC name is N',N'-diethyl-N-[2-[(Z)-2-(5-nitrofuran-2-yl)ethenyl]quinolin-8-yl]propane-1,3-diamine.
Molecular Properties
| Compound Name | N',N'-diethyl-N-[2-[(Z)-2-(5-nitrofuran-2-yl)ethenyl]quinolin-8-yl]propane-1,3-diamine |
| PubChem CID | 24843304 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | N',N'-diethyl-N-[2-[(Z)-2-(5-nitrofuran-2-yl)ethenyl]quinolin-8-yl]propane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1cccc2ccc(/C=C\c3ccc([N+](=O)[O-])o3)nc12 |
| InChI | InChI=1S/C22H26N4O3/c1-3-25(4-2)16-6-15-23-20-8-5-7-17-9-10-18(24-22(17)20)11-12-19-13-14-21(29-19)26(27)28/h5,7-14,23H,3-4,6,15-16H2,1-2H3/b12-11- |
| InChIKey | VUEYLFLHZUSGFW-QXMHVHEDSA-N |
| XLogP | 5.05 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N',N'-diethyl-N-[2-[(Z)-2-(5-nitrofuran-2-yl)ethenyl]quinolin-8-yl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-diethyl-N-[2-[(Z)-2-(5-nitrofuran-2-yl)ethenyl]quinolin-8-yl]propane-1,3-diamine?
The IUPAC name of N',N'-diethyl-N-[2-[(Z)-2-(5-nitrofuran-2-yl)ethenyl]quinolin-8-yl]propane-1,3-diamine (CID 24843304) is N',N'-diethyl-N-[2-[(Z)-2-(5-nitrofuran-2-yl)ethenyl]quinolin-8-yl]propane-1,3-diamine.
What is the SMILES notation for N',N'-diethyl-N-[2-[(Z)-2-(5-nitrofuran-2-yl)ethenyl]quinolin-8-yl]propane-1,3-diamine?
The canonical SMILES for N',N'-diethyl-N-[2-[(Z)-2-(5-nitrofuran-2-yl)ethenyl]quinolin-8-yl]propane-1,3-diamine is CCN(CC)CCCNc1cccc2ccc(/C=C\c3ccc([N+](=O)[O-])o3)nc12.
What is the InChIKey of N',N'-diethyl-N-[2-[(Z)-2-(5-nitrofuran-2-yl)ethenyl]quinolin-8-yl]propane-1,3-diamine?
The InChIKey is VUEYLFLHZUSGFW-QXMHVHEDSA-N. The full InChI is InChI=1S/C22H26N4O3/c1-3-25(4-2)16-6-15-23-20-8-5-7-17-9-10-18(24-22(17)20)11-12-19-13-14-21(29-19)26(27)28/h5,7-14,23H,3-4,6,15-16H2,1-2H3/b12-11-.
What are the key properties of N',N'-diethyl-N-[2-[(Z)-2-(5-nitrofuran-2-yl)ethenyl]quinolin-8-yl]propane-1,3-diamine?
N',N'-diethyl-N-[2-[(Z)-2-(5-nitrofuran-2-yl)ethenyl]quinolin-8-yl]propane-1,3-diamine has a molecular weight of 394.48 g/mol, XLogP of 5.05, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-diethyl-N-[2-[(Z)-2-(5-nitrofuran-2-yl)ethenyl]quinolin-8-yl]propane-1,3-diamine is sourced from PubChem (CID 24843304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).