About (1,3-dichloropropan-2-ylideneamino) (Z)-but-2-enoate
(1,3-dichloropropan-2-ylideneamino) (Z)-but-2-enoate (PubChem CID 24843576) has the molecular formula C7H9Cl2NO2
and a molecular weight of 210.06 g/mol. Its IUPAC name is (1,3-dichloropropan-2-ylideneamino) (Z)-but-2-enoate.
Molecular Properties
| Compound Name | (1,3-dichloropropan-2-ylideneamino) (Z)-but-2-enoate |
| PubChem CID | 24843576 |
| Molecular Formula | C7H9Cl2NO2 |
| Molecular Weight | 210.06 g/mol |
| Exact Mass | 209.00 |
| IUPAC Name | (1,3-dichloropropan-2-ylideneamino) (Z)-but-2-enoate |
| SMILES | C/C=C\C(=O)ON=C(CCl)CCl |
| InChI | InChI=1S/C7H9Cl2NO2/c1-2-3-7(11)12-10-6(4-8)5-9/h2-3H,4-5H2,1H3/b3-2- |
| InChIKey | QWPBETCEPDTFHL-IHWYPQMZSA-N |
| XLogP | 1.94 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.06 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1,3-dichloropropan-2-ylideneamino) (Z)-but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,3-dichloropropan-2-ylideneamino) (Z)-but-2-enoate?
The IUPAC name of (1,3-dichloropropan-2-ylideneamino) (Z)-but-2-enoate (CID 24843576) is (1,3-dichloropropan-2-ylideneamino) (Z)-but-2-enoate.
What is the SMILES notation for (1,3-dichloropropan-2-ylideneamino) (Z)-but-2-enoate?
The canonical SMILES for (1,3-dichloropropan-2-ylideneamino) (Z)-but-2-enoate is C/C=C\C(=O)ON=C(CCl)CCl.
What is the InChIKey of (1,3-dichloropropan-2-ylideneamino) (Z)-but-2-enoate?
The InChIKey is QWPBETCEPDTFHL-IHWYPQMZSA-N. The full InChI is InChI=1S/C7H9Cl2NO2/c1-2-3-7(11)12-10-6(4-8)5-9/h2-3H,4-5H2,1H3/b3-2-.
What are the key properties of (1,3-dichloropropan-2-ylideneamino) (Z)-but-2-enoate?
(1,3-dichloropropan-2-ylideneamino) (Z)-but-2-enoate has a molecular weight of 210.06 g/mol, XLogP of 1.94, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-dichloropropan-2-ylideneamino) (Z)-but-2-enoate is sourced from PubChem (CID 24843576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).