C21H29ClN4O2 — CID 24843878
1-[(Z)-[3-(diethylamino)-1-phenylpropylidene]amino]-3-(4-methoxyphenyl)urea;hydrochloride (PubChem CID 24843878) has the molecular formula C21H29ClN4O2 and a molecular weight of 404.94 g/mol. Its IUPAC name is 1-[(Z)-[3-(diethylamino)-1-phenylpropylidene]amino]-3-(4-methoxyphenyl)urea;hydrochloride.
| Compound Name | 1-[(Z)-[3-(diethylamino)-1-phenylpropylidene]amino]-3-(4-methoxyphenyl)urea;hydrochloride |
|---|---|
| PubChem CID | 24843878 |
| Molecular Formula | C21H29ClN4O2 |
| Molecular Weight | 404.94 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 1-[(Z)-[3-(diethylamino)-1-phenylpropylidene]amino]-3-(4-methoxyphenyl)urea;hydrochloride |
| SMILES | CCN(CC)CC/C(=N/NC(=O)Nc1ccc(OC)cc1)c1ccccc1.Cl |
| InChI | InChI=1S/C21H28N4O2.ClH/c1-4-25(5-2)16-15-20(17-9-7-6-8-10-17)23-24-21(26)22-18-11-13-19(27-3)14-12-18;/h6-14H,4-5,15-16H2,1-3H3,(H2,22,24,26);1H/b23-20-; |
| InChIKey | RXTPSNSIZGSEDJ-QTXBERLJSA-N |
| XLogP | 4.37 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.94 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|