About 2-chloro-N,N-diethyl-1-methoxypropan-1-amine;hydrochloride
2-chloro-N,N-diethyl-1-methoxypropan-1-amine;hydrochloride (PubChem CID 24843964) has the molecular formula C8H19Cl2NO
and a molecular weight of 216.15 g/mol. Its IUPAC name is 2-chloro-N,N-diethyl-1-methoxypropan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 2-chloro-N,N-diethyl-1-methoxypropan-1-amine;hydrochloride |
| PubChem CID | 24843964 |
| Molecular Formula | C8H19Cl2NO |
| Molecular Weight | 216.15 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 2-chloro-N,N-diethyl-1-methoxypropan-1-amine;hydrochloride |
| SMILES | CCN(CC)C(OC)C(C)Cl.Cl |
| InChI | InChI=1S/C8H18ClNO.ClH/c1-5-10(6-2)8(11-4)7(3)9;/h7-8H,5-6H2,1-4H3;1H |
| InChIKey | XJIDKBLZGLTPAG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.15 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N,N-diethyl-1-methoxypropan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N,N-diethyl-1-methoxypropan-1-amine;hydrochloride?
The IUPAC name of 2-chloro-N,N-diethyl-1-methoxypropan-1-amine;hydrochloride (CID 24843964) is 2-chloro-N,N-diethyl-1-methoxypropan-1-amine;hydrochloride.
What is the SMILES notation for 2-chloro-N,N-diethyl-1-methoxypropan-1-amine;hydrochloride?
The canonical SMILES for 2-chloro-N,N-diethyl-1-methoxypropan-1-amine;hydrochloride is CCN(CC)C(OC)C(C)Cl.Cl.
What is the InChIKey of 2-chloro-N,N-diethyl-1-methoxypropan-1-amine;hydrochloride?
The InChIKey is XJIDKBLZGLTPAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18ClNO.ClH/c1-5-10(6-2)8(11-4)7(3)9;/h7-8H,5-6H2,1-4H3;1H.
What are the key properties of 2-chloro-N,N-diethyl-1-methoxypropan-1-amine;hydrochloride?
2-chloro-N,N-diethyl-1-methoxypropan-1-amine;hydrochloride has a molecular weight of 216.15 g/mol, XLogP of 2.35, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N,N-diethyl-1-methoxypropan-1-amine;hydrochloride is sourced from PubChem (CID 24843964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).