C21H37FO5 — CID 24843992
methyl (Z)-7-[(1S,2S,3R,5S)-2-fluoro-3,5-dihydroxy-2-[(3R)-3-hydroxyoctyl]cyclopentyl]hept-5-enoate (PubChem CID 24843992) has the molecular formula C21H37FO5 and a molecular weight of 388.52 g/mol. Its IUPAC name is methyl (Z)-7-[(1S,2S,3R,5S)-2-fluoro-3,5-dihydroxy-2-[(3R)-3-hydroxyoctyl]cyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1S,2S,3R,5S)-2-fluoro-3,5-dihydroxy-2-[(3R)-3-hydroxyoctyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 24843992 |
| Molecular Formula | C21H37FO5 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | methyl (Z)-7-[(1S,2S,3R,5S)-2-fluoro-3,5-dihydroxy-2-[(3R)-3-hydroxyoctyl]cyclopentyl]hept-5-enoate |
| SMILES | CCCCC[C@@H](O)CC[C@@]1(F)[C@H](O)C[C@H](O)[C@@H]1C/C=C\CCCC(=O)OC |
| InChI | InChI=1S/C21H37FO5/c1-3-4-7-10-16(23)13-14-21(22)17(18(24)15-19(21)25)11-8-5-6-9-12-20(26)27-2/h5,8,16-19,23-25H,3-4,6-7,9-15H2,1-2H3/b8-5-/t16-,17+,18+,19-,21+/m1/s1 |
| InChIKey | HQOJGQYUAGMIPU-FVFRQAGZSA-N |
| XLogP | 3.45 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|