C14H11Cl2F10NO2 — CID 24844546
2-[chloro(difluoro)methyl]-2-[2-[1-chloro-1,1,3,3,3-pentafluoro-2-(hydroxymethyl)propan-2-yl]-6-methyl-4-pyridinyl]-3,3,3-trifluoropropan-1-ol (PubChem CID 24844546) has the molecular formula C14H11Cl2F10NO2 and a molecular weight of 486.13 g/mol. Its IUPAC name is 2-[chloro(difluoro)methyl]-2-[2-[1-chloro-1,1,3,3,3-pentafluoro-2-(hydroxymethyl)propan-2-yl]-6-methyl-4-pyridinyl]-3,3,3-trifluoropropan-1-ol.
| Compound Name | 2-[chloro(difluoro)methyl]-2-[2-[1-chloro-1,1,3,3,3-pentafluoro-2-(hydroxymethyl)propan-2-yl]-6-methyl-4-pyridinyl]-3,3,3-trifluoropropan-1-ol |
|---|---|
| PubChem CID | 24844546 |
| Molecular Formula | C14H11Cl2F10NO2 |
| Molecular Weight | 486.13 g/mol |
| Exact Mass | 485.00 |
| IUPAC Name | 2-[chloro(difluoro)methyl]-2-[2-[1-chloro-1,1,3,3,3-pentafluoro-2-(hydroxymethyl)propan-2-yl]-6-methyl-4-pyridinyl]-3,3,3-trifluoropropan-1-ol |
| SMILES | Cc1cc(C(CO)(C(F)(F)F)C(F)(F)Cl)cc(C(CO)(C(F)(F)F)C(F)(F)Cl)n1 |
| InChI | InChI=1S/C14H11Cl2F10NO2/c1-6-2-7(9(4-28,11(15,17)18)13(21,22)23)3-8(27-6)10(5-29,12(16,19)20)14(24,25)26/h2-3,28-29H,4-5H2,1H3 |
| InChIKey | UMERTVLIOYXKRM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.13 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|