C14H11F12NO2 — CID 24844547
3,3,3-trifluoro-2-[2-[1,1,1,3,3,3-hexafluoro-2-(hydroxymethyl)propan-2-yl]-6-methyl-4-pyridinyl]-2-(trifluoromethyl)propan-1-ol (PubChem CID 24844547) has the molecular formula C14H11F12NO2 and a molecular weight of 453.22 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[2-[1,1,1,3,3,3-hexafluoro-2-(hydroxymethyl)propan-2-yl]-6-methyl-4-pyridinyl]-2-(trifluoromethyl)propan-1-ol.
| Compound Name | 3,3,3-trifluoro-2-[2-[1,1,1,3,3,3-hexafluoro-2-(hydroxymethyl)propan-2-yl]-6-methyl-4-pyridinyl]-2-(trifluoromethyl)propan-1-ol |
|---|---|
| PubChem CID | 24844547 |
| Molecular Formula | C14H11F12NO2 |
| Molecular Weight | 453.22 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | 3,3,3-trifluoro-2-[2-[1,1,1,3,3,3-hexafluoro-2-(hydroxymethyl)propan-2-yl]-6-methyl-4-pyridinyl]-2-(trifluoromethyl)propan-1-ol |
| SMILES | Cc1cc(C(CO)(C(F)(F)F)C(F)(F)F)cc(C(CO)(C(F)(F)F)C(F)(F)F)n1 |
| InChI | InChI=1S/C14H11F12NO2/c1-6-2-7(9(4-28,11(15,16)17)12(18,19)20)3-8(27-6)10(5-29,13(21,22)23)14(24,25)26/h2-3,28-29H,4-5H2,1H3 |
| InChIKey | ULLWQEFUQHHPGB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.22 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |