C23H32Br2N- — CID 24844759
3,16-dimethyl-7-azoniatricyclo[16.2.2.07,12]docosa-1(21),7,9,11,18(22),19-hexaene dibromide (PubChem CID 24844759) has the molecular formula C23H32Br2N- and a molecular weight of 482.32 g/mol. Its IUPAC name is 3,16-dimethyl-7-azoniatricyclo[16.2.2.07,12]docosa-1(21),7,9,11,18(22),19-hexaene dibromide.
| Compound Name | 3,16-dimethyl-7-azoniatricyclo[16.2.2.07,12]docosa-1(21),7,9,11,18(22),19-hexaene dibromide |
|---|---|
| PubChem CID | 24844759 |
| Molecular Formula | C23H32Br2N- |
| Molecular Weight | 482.32 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | 3,16-dimethyl-7-azoniatricyclo[16.2.2.07,12]docosa-1(21),7,9,11,18(22),19-hexaene dibromide |
| SMILES | CC1CCCc2cccc[n+]2CCCC(C)Cc2ccc(cc2)C1.[Br-].[Br-] |
| InChI | InChI=1S/C23H32N.2BrH/c1-19-7-5-10-23-9-3-4-15-24(23)16-6-8-20(2)18-22-13-11-21(17-19)12-14-22;;/h3-4,9,11-15,19-20H,5-8,10,16-18H2,1-2H3;2*1H/q+1;;/p-2 |
| InChIKey | QLVDXYIOISNPKP-UHFFFAOYSA-L |
| XLogP | -0.84 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.32 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|