C19H27N3O5 — CID 24844787
(E)-but-2-enedioic acid;5-[2-(diethylamino)ethyl]-8,9-dihydro-7H-pyrido[3,2-b]azepin-6-one (PubChem CID 24844787) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;5-[2-(diethylamino)ethyl]-8,9-dihydro-7H-pyrido[3,2-b]azepin-6-one.
| Compound Name | (E)-but-2-enedioic acid;5-[2-(diethylamino)ethyl]-8,9-dihydro-7H-pyrido[3,2-b]azepin-6-one |
|---|---|
| PubChem CID | 24844787 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | (E)-but-2-enedioic acid;5-[2-(diethylamino)ethyl]-8,9-dihydro-7H-pyrido[3,2-b]azepin-6-one |
| SMILES | CCN(CC)CCN1C(=O)CCCc2ncccc21.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C15H23N3O.C4H4O4/c1-3-17(4-2)11-12-18-14-8-6-10-16-13(14)7-5-9-15(18)19;5-3(6)1-2-4(7)8/h6,8,10H,3-5,7,9,11-12H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | QVHINOZURQSJCA-WLHGVMLRSA-N |
| XLogP | 1.80 |
| TPSA | 111.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|