About 2-methyl-4-(2-phenylethyl)pyrido[3,2-b][1,4]oxazin-3-one;hydrochloride
2-methyl-4-(2-phenylethyl)pyrido[3,2-b][1,4]oxazin-3-one;hydrochloride (PubChem CID 24844934) has the molecular formula C16H17ClN2O2
and a molecular weight of 304.78 g/mol. Its IUPAC name is 2-methyl-4-(2-phenylethyl)pyrido[3,2-b][1,4]oxazin-3-one;hydrochloride.
Molecular Properties
| Compound Name | 2-methyl-4-(2-phenylethyl)pyrido[3,2-b][1,4]oxazin-3-one;hydrochloride |
| PubChem CID | 24844934 |
| Molecular Formula | C16H17ClN2O2 |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 2-methyl-4-(2-phenylethyl)pyrido[3,2-b][1,4]oxazin-3-one;hydrochloride |
| SMILES | CC1Oc2cccnc2N(CCc2ccccc2)C1=O.Cl |
| InChI | InChI=1S/C16H16N2O2.ClH/c1-12-16(19)18(11-9-13-6-3-2-4-7-13)15-14(20-12)8-5-10-17-15;/h2-8,10,12H,9,11H2,1H3;1H |
| InChIKey | SEJPUIBHOYIANS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-4-(2-phenylethyl)pyrido[3,2-b][1,4]oxazin-3-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-(2-phenylethyl)pyrido[3,2-b][1,4]oxazin-3-one;hydrochloride?
The IUPAC name of 2-methyl-4-(2-phenylethyl)pyrido[3,2-b][1,4]oxazin-3-one;hydrochloride (CID 24844934) is 2-methyl-4-(2-phenylethyl)pyrido[3,2-b][1,4]oxazin-3-one;hydrochloride.
What is the SMILES notation for 2-methyl-4-(2-phenylethyl)pyrido[3,2-b][1,4]oxazin-3-one;hydrochloride?
The canonical SMILES for 2-methyl-4-(2-phenylethyl)pyrido[3,2-b][1,4]oxazin-3-one;hydrochloride is CC1Oc2cccnc2N(CCc2ccccc2)C1=O.Cl.
What is the InChIKey of 2-methyl-4-(2-phenylethyl)pyrido[3,2-b][1,4]oxazin-3-one;hydrochloride?
The InChIKey is SEJPUIBHOYIANS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O2.ClH/c1-12-16(19)18(11-9-13-6-3-2-4-7-13)15-14(20-12)8-5-10-17-15;/h2-8,10,12H,9,11H2,1H3;1H.
What are the key properties of 2-methyl-4-(2-phenylethyl)pyrido[3,2-b][1,4]oxazin-3-one;hydrochloride?
2-methyl-4-(2-phenylethyl)pyrido[3,2-b][1,4]oxazin-3-one;hydrochloride has a molecular weight of 304.78 g/mol, XLogP of 2.86, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-(2-phenylethyl)pyrido[3,2-b][1,4]oxazin-3-one;hydrochloride is sourced from PubChem (CID 24844934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).