C18H29Cl2N3O2 — CID 24845238
N-[2-[(2-hydroxyphenyl)methylamino]ethyl]-2,2,5,5-tetramethyl-1H-pyrrole-3-carboxamide;dihydrochloride (PubChem CID 24845238) has the molecular formula C18H29Cl2N3O2 and a molecular weight of 390.36 g/mol. Its IUPAC name is N-[2-[(2-hydroxyphenyl)methylamino]ethyl]-2,2,5,5-tetramethyl-1H-pyrrole-3-carboxamide;dihydrochloride.
| Compound Name | N-[2-[(2-hydroxyphenyl)methylamino]ethyl]-2,2,5,5-tetramethyl-1H-pyrrole-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 24845238 |
| Molecular Formula | C18H29Cl2N3O2 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | N-[2-[(2-hydroxyphenyl)methylamino]ethyl]-2,2,5,5-tetramethyl-1H-pyrrole-3-carboxamide;dihydrochloride |
| SMILES | CC1(C)C=C(C(=O)NCCNCc2ccccc2O)C(C)(C)N1.Cl.Cl |
| InChI | InChI=1S/C18H27N3O2.2ClH/c1-17(2)11-14(18(3,4)21-17)16(23)20-10-9-19-12-13-7-5-6-8-15(13)22;;/h5-8,11,19,21-22H,9-10,12H2,1-4H3,(H,20,23);2*1H |
| InChIKey | NGPWLCGRTUGCQI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|