C17H29Cl2N3OS — CID 24845303
2,2,5,5-tetramethyl-N-[3-(thiophen-3-ylmethylamino)propyl]-1H-pyrrole-3-carboxamide;dihydrochloride (PubChem CID 24845303) has the molecular formula C17H29Cl2N3OS and a molecular weight of 394.41 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-N-[3-(thiophen-3-ylmethylamino)propyl]-1H-pyrrole-3-carboxamide;dihydrochloride.
| Compound Name | 2,2,5,5-tetramethyl-N-[3-(thiophen-3-ylmethylamino)propyl]-1H-pyrrole-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 24845303 |
| Molecular Formula | C17H29Cl2N3OS |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 2,2,5,5-tetramethyl-N-[3-(thiophen-3-ylmethylamino)propyl]-1H-pyrrole-3-carboxamide;dihydrochloride |
| SMILES | CC1(C)C=C(C(=O)NCCCNCc2ccsc2)C(C)(C)N1.Cl.Cl |
| InChI | InChI=1S/C17H27N3OS.2ClH/c1-16(2)10-14(17(3,4)20-16)15(21)19-8-5-7-18-11-13-6-9-22-12-13;;/h6,9-10,12,18,20H,5,7-8,11H2,1-4H3,(H,19,21);2*1H |
| InChIKey | JQPKGGUJAAVUDO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|