C17H27N3OS — CID 24845304
2,2,5,5-tetramethyl-N-[3-(thiophen-3-ylmethylamino)propyl]-1H-pyrrole-3-carboxamide (PubChem CID 24845304) has the molecular formula C17H27N3OS and a molecular weight of 321.49 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-N-[3-(thiophen-3-ylmethylamino)propyl]-1H-pyrrole-3-carboxamide.
| Compound Name | 2,2,5,5-tetramethyl-N-[3-(thiophen-3-ylmethylamino)propyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 24845304 |
| Molecular Formula | C17H27N3OS |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 2,2,5,5-tetramethyl-N-[3-(thiophen-3-ylmethylamino)propyl]-1H-pyrrole-3-carboxamide |
| SMILES | CC1(C)C=C(C(=O)NCCCNCc2ccsc2)C(C)(C)N1 |
| InChI | InChI=1S/C17H27N3OS/c1-16(2)10-14(17(3,4)20-16)15(21)19-8-5-7-18-11-13-6-9-22-12-13/h6,9-10,12,18,20H,5,7-8,11H2,1-4H3,(H,19,21) |
| InChIKey | AFMCIEBFOKWJTQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|