C7H11NO2S — CID 24846698
5,5-diethyl-1,3-thiazolidine-2,4-dione (PubChem CID 24846698) has the molecular formula C7H11NO2S and a molecular weight of 173.24 g/mol. Its IUPAC name is 5,5-diethyl-1,3-thiazolidine-2,4-dione.
| Compound Name | 5,5-diethyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 24846698 |
| Molecular Formula | C7H11NO2S |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.05 |
| IUPAC Name | 5,5-diethyl-1,3-thiazolidine-2,4-dione |
| SMILES | CCC1(CC)SC(=O)NC1=O |
| InChI | InChI=1S/C7H11NO2S/c1-3-7(4-2)5(9)8-6(10)11-7/h3-4H2,1-2H3,(H,8,9,10) |
| InChIKey | ICKLQYXMLPQXJG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|