About N-(4-butylsulfanylphenyl)-4,5-dihydro-1,3-thiazol-2-amine;hydrochloride
N-(4-butylsulfanylphenyl)-4,5-dihydro-1,3-thiazol-2-amine;hydrochloride (PubChem CID 24846776) has the molecular formula C13H19ClN2S2
and a molecular weight of 302.90 g/mol. Its IUPAC name is N-(4-butylsulfanylphenyl)-4,5-dihydro-1,3-thiazol-2-amine;hydrochloride.
Molecular Properties
| Compound Name | N-(4-butylsulfanylphenyl)-4,5-dihydro-1,3-thiazol-2-amine;hydrochloride |
| PubChem CID | 24846776 |
| Molecular Formula | C13H19ClN2S2 |
| Molecular Weight | 302.90 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | N-(4-butylsulfanylphenyl)-4,5-dihydro-1,3-thiazol-2-amine;hydrochloride |
| SMILES | CCCCSc1ccc(NC2=NCCS2)cc1.Cl |
| InChI | InChI=1S/C13H18N2S2.ClH/c1-2-3-9-16-12-6-4-11(5-7-12)15-13-14-8-10-17-13;/h4-7H,2-3,8-10H2,1H3,(H,14,15);1H |
| InChIKey | WISSVSHXMSEQRT-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.90 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(4-butylsulfanylphenyl)-4,5-dihydro-1,3-thiazol-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-butylsulfanylphenyl)-4,5-dihydro-1,3-thiazol-2-amine;hydrochloride?
The IUPAC name of N-(4-butylsulfanylphenyl)-4,5-dihydro-1,3-thiazol-2-amine;hydrochloride (CID 24846776) is N-(4-butylsulfanylphenyl)-4,5-dihydro-1,3-thiazol-2-amine;hydrochloride.
What is the SMILES notation for N-(4-butylsulfanylphenyl)-4,5-dihydro-1,3-thiazol-2-amine;hydrochloride?
The canonical SMILES for N-(4-butylsulfanylphenyl)-4,5-dihydro-1,3-thiazol-2-amine;hydrochloride is CCCCSc1ccc(NC2=NCCS2)cc1.Cl.
What is the InChIKey of N-(4-butylsulfanylphenyl)-4,5-dihydro-1,3-thiazol-2-amine;hydrochloride?
The InChIKey is WISSVSHXMSEQRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2S2.ClH/c1-2-3-9-16-12-6-4-11(5-7-12)15-13-14-8-10-17-13;/h4-7H,2-3,8-10H2,1H3,(H,14,15);1H.
What are the key properties of N-(4-butylsulfanylphenyl)-4,5-dihydro-1,3-thiazol-2-amine;hydrochloride?
N-(4-butylsulfanylphenyl)-4,5-dihydro-1,3-thiazol-2-amine;hydrochloride has a molecular weight of 302.90 g/mol, XLogP of 4.52, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-butylsulfanylphenyl)-4,5-dihydro-1,3-thiazol-2-amine;hydrochloride is sourced from PubChem (CID 24846776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).