C17H10N4O4S — CID 24846833
(6E)-6-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]-3-phenyl-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-one (PubChem CID 24846833) has the molecular formula C17H10N4O4S and a molecular weight of 366.36 g/mol. Its IUPAC name is (6E)-6-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]-3-phenyl-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-one.
| Compound Name | (6E)-6-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]-3-phenyl-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-one |
|---|---|
| PubChem CID | 24846833 |
| Molecular Formula | C17H10N4O4S |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | (6E)-6-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]-3-phenyl-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-one |
| SMILES | O=c1/c(=C\C=C\c2ccc([N+](=O)[O-])o2)sc2nnc(-c3ccccc3)n12 |
| InChI | InChI=1S/C17H10N4O4S/c22-16-13(8-4-7-12-9-10-14(25-12)21(23)24)26-17-19-18-15(20(16)17)11-5-2-1-3-6-11/h1-10H/b7-4+,13-8+ |
| InChIKey | QRQZQRHUMUDHNN-ZAUJTXRMSA-N |
| XLogP | 2.53 |
| TPSA | 103.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|