C27H30BrClN6O5S2 — CID 24846865
4-bromo-7-(2-chlorophenyl)-13-[4-(2-phenoxyethyl)piperazin-1-yl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene;methanesulfonic acid;hydrate (PubChem CID 24846865) has the molecular formula C27H30BrClN6O5S2 and a molecular weight of 698.07 g/mol. Its IUPAC name is 4-bromo-7-(2-chlorophenyl)-13-[4-(2-phenoxyethyl)piperazin-1-yl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene;methanesulfonic acid;hydrate.
| Compound Name | 4-bromo-7-(2-chlorophenyl)-13-[4-(2-phenoxyethyl)piperazin-1-yl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene;methanesulfonic acid;hydrate |
|---|---|
| PubChem CID | 24846865 |
| Molecular Formula | C27H30BrClN6O5S2 |
| Molecular Weight | 698.07 g/mol |
| Exact Mass | 696.06 |
| IUPAC Name | 4-bromo-7-(2-chlorophenyl)-13-[4-(2-phenoxyethyl)piperazin-1-yl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene;methanesulfonic acid;hydrate |
| SMILES | CS(=O)(=O)O.Clc1ccccc1C1=NCc2nnc(N3CCN(CCOc4ccccc4)CC3)n2-c2sc(Br)cc21.O |
| InChI | InChI=1S/C26H24BrClN6OS.CH4O3S.H2O/c27-22-16-20-24(19-8-4-5-9-21(19)28)29-17-23-30-31-26(34(23)25(20)36-22)33-12-10-32(11-13-33)14-15-35-18-6-2-1-3-7-18;1-5(2,3)4;/h1-9,16H,10-15,17H2;1H3,(H,2,3,4);1H2 |
| InChIKey | BXMVIXYOXOYLPC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 144.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.07 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|