About 3-(2,5-dimethylpyrrol-1-yl)propyl thiophene-2-carboxylate
3-(2,5-dimethylpyrrol-1-yl)propyl thiophene-2-carboxylate (PubChem CID 24846929) has the molecular formula C14H17NO2S
and a molecular weight of 263.36 g/mol. Its IUPAC name is 3-(2,5-dimethylpyrrol-1-yl)propyl thiophene-2-carboxylate.
Molecular Properties
| Compound Name | 3-(2,5-dimethylpyrrol-1-yl)propyl thiophene-2-carboxylate |
| PubChem CID | 24846929 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 3-(2,5-dimethylpyrrol-1-yl)propyl thiophene-2-carboxylate |
| SMILES | Cc1ccc(C)n1CCCOC(=O)c1cccs1 |
| InChI | InChI=1S/C14H17NO2S/c1-11-6-7-12(2)15(11)8-4-9-17-14(16)13-5-3-10-18-13/h3,5-7,10H,4,8-9H2,1-2H3 |
| InChIKey | CCZCWAYEVADLRI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,5-dimethylpyrrol-1-yl)propyl thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dimethylpyrrol-1-yl)propyl thiophene-2-carboxylate?
The IUPAC name of 3-(2,5-dimethylpyrrol-1-yl)propyl thiophene-2-carboxylate (CID 24846929) is 3-(2,5-dimethylpyrrol-1-yl)propyl thiophene-2-carboxylate.
What is the SMILES notation for 3-(2,5-dimethylpyrrol-1-yl)propyl thiophene-2-carboxylate?
The canonical SMILES for 3-(2,5-dimethylpyrrol-1-yl)propyl thiophene-2-carboxylate is Cc1ccc(C)n1CCCOC(=O)c1cccs1.
What is the InChIKey of 3-(2,5-dimethylpyrrol-1-yl)propyl thiophene-2-carboxylate?
The InChIKey is CCZCWAYEVADLRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO2S/c1-11-6-7-12(2)15(11)8-4-9-17-14(16)13-5-3-10-18-13/h3,5-7,10H,4,8-9H2,1-2H3.
What are the key properties of 3-(2,5-dimethylpyrrol-1-yl)propyl thiophene-2-carboxylate?
3-(2,5-dimethylpyrrol-1-yl)propyl thiophene-2-carboxylate has a molecular weight of 263.36 g/mol, XLogP of 3.41, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dimethylpyrrol-1-yl)propyl thiophene-2-carboxylate is sourced from PubChem (CID 24846929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).