C18H24N2O4S — CID 24846956
oxalic acid;N-(2,3,4,9-tetrahydrothiopyrano[2,3-b]indol-4-ylmethyl)butan-1-amine (PubChem CID 24846956) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is oxalic acid;N-(2,3,4,9-tetrahydrothiopyrano[2,3-b]indol-4-ylmethyl)butan-1-amine.
| Compound Name | oxalic acid;N-(2,3,4,9-tetrahydrothiopyrano[2,3-b]indol-4-ylmethyl)butan-1-amine |
|---|---|
| PubChem CID | 24846956 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | oxalic acid;N-(2,3,4,9-tetrahydrothiopyrano[2,3-b]indol-4-ylmethyl)butan-1-amine |
| SMILES | CCCCNCC1CCSc2[nH]c3ccccc3c21.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H22N2S.C2H2O4/c1-2-3-9-17-11-12-8-10-19-16-15(12)13-6-4-5-7-14(13)18-16;3-1(4)2(5)6/h4-7,12,17-18H,2-3,8-11H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | MMVWFNYTGIMZQF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|