C19H27N7O2 — CID 24847158
6-amino-2-methyl-5-[[(Z)-4-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]but-2-enyl]amino]-1,2,4-triazin-3-one (PubChem CID 24847158) has the molecular formula C19H27N7O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 6-amino-2-methyl-5-[[(Z)-4-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]but-2-enyl]amino]-1,2,4-triazin-3-one.
| Compound Name | 6-amino-2-methyl-5-[[(Z)-4-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]but-2-enyl]amino]-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 24847158 |
| Molecular Formula | C19H27N7O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 6-amino-2-methyl-5-[[(Z)-4-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]but-2-enyl]amino]-1,2,4-triazin-3-one |
| SMILES | Cn1nc(N)c(NC/C=C\COc2cc(CN3CCCCC3)ccn2)nc1=O |
| InChI | InChI=1S/C19H27N7O2/c1-25-19(27)23-18(17(20)24-25)22-8-3-6-12-28-16-13-15(7-9-21-16)14-26-10-4-2-5-11-26/h3,6-7,9,13H,2,4-5,8,10-12,14H2,1H3,(H2,20,24)(H,22,23,27)/b6-3- |
| InChIKey | ARXQFNNCFAINRR-UTCJRWHESA-N |
| XLogP | 1.19 |
| TPSA | 111.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|