About N-[2-(2,2-diphenylethoxy)ethyl]-N-propan-2-ylpropan-2-amine;hydrochloride
N-[2-(2,2-diphenylethoxy)ethyl]-N-propan-2-ylpropan-2-amine;hydrochloride (PubChem CID 24847330) has the molecular formula C22H32ClNO
and a molecular weight of 361.96 g/mol. Its IUPAC name is N-[2-(2,2-diphenylethoxy)ethyl]-N-propan-2-ylpropan-2-amine;hydrochloride.
Molecular Properties
| Compound Name | N-[2-(2,2-diphenylethoxy)ethyl]-N-propan-2-ylpropan-2-amine;hydrochloride |
| PubChem CID | 24847330 |
| Molecular Formula | C22H32ClNO |
| Molecular Weight | 361.96 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | N-[2-(2,2-diphenylethoxy)ethyl]-N-propan-2-ylpropan-2-amine;hydrochloride |
| SMILES | CC(C)N(CCOCC(c1ccccc1)c1ccccc1)C(C)C.Cl |
| InChI | InChI=1S/C22H31NO.ClH/c1-18(2)23(19(3)4)15-16-24-17-22(20-11-7-5-8-12-20)21-13-9-6-10-14-21;/h5-14,18-19,22H,15-17H2,1-4H3;1H |
| InChIKey | XZPQMJFKYIZHBX-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.96 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2,2-diphenylethoxy)ethyl]-N-propan-2-ylpropan-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,2-diphenylethoxy)ethyl]-N-propan-2-ylpropan-2-amine;hydrochloride?
The IUPAC name of N-[2-(2,2-diphenylethoxy)ethyl]-N-propan-2-ylpropan-2-amine;hydrochloride (CID 24847330) is N-[2-(2,2-diphenylethoxy)ethyl]-N-propan-2-ylpropan-2-amine;hydrochloride.
What is the SMILES notation for N-[2-(2,2-diphenylethoxy)ethyl]-N-propan-2-ylpropan-2-amine;hydrochloride?
The canonical SMILES for N-[2-(2,2-diphenylethoxy)ethyl]-N-propan-2-ylpropan-2-amine;hydrochloride is CC(C)N(CCOCC(c1ccccc1)c1ccccc1)C(C)C.Cl.
What is the InChIKey of N-[2-(2,2-diphenylethoxy)ethyl]-N-propan-2-ylpropan-2-amine;hydrochloride?
The InChIKey is XZPQMJFKYIZHBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31NO.ClH/c1-18(2)23(19(3)4)15-16-24-17-22(20-11-7-5-8-12-20)21-13-9-6-10-14-21;/h5-14,18-19,22H,15-17H2,1-4H3;1H.
What are the key properties of N-[2-(2,2-diphenylethoxy)ethyl]-N-propan-2-ylpropan-2-amine;hydrochloride?
N-[2-(2,2-diphenylethoxy)ethyl]-N-propan-2-ylpropan-2-amine;hydrochloride has a molecular weight of 361.96 g/mol, XLogP of 5.38, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,2-diphenylethoxy)ethyl]-N-propan-2-ylpropan-2-amine;hydrochloride is sourced from PubChem (CID 24847330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).