C23H27ClO4 — CID 24847689
9-(2-chlorophenyl)-4a-hydroxy-3,3,7,7-tetramethyl-2,4,5,6,9,9a-hexahydroxanthene-1,8-dione (PubChem CID 24847689) has the molecular formula C23H27ClO4 and a molecular weight of 402.92 g/mol. Its IUPAC name is 9-(2-chlorophenyl)-4a-hydroxy-3,3,7,7-tetramethyl-2,4,5,6,9,9a-hexahydroxanthene-1,8-dione.
| Compound Name | 9-(2-chlorophenyl)-4a-hydroxy-3,3,7,7-tetramethyl-2,4,5,6,9,9a-hexahydroxanthene-1,8-dione |
|---|---|
| PubChem CID | 24847689 |
| Molecular Formula | C23H27ClO4 |
| Molecular Weight | 402.92 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 9-(2-chlorophenyl)-4a-hydroxy-3,3,7,7-tetramethyl-2,4,5,6,9,9a-hexahydroxanthene-1,8-dione |
| SMILES | CC1(C)CC(=O)C2C(c3ccccc3Cl)C3=C(CCC(C)(C)C3=O)OC2(O)C1 |
| InChI | InChI=1S/C23H27ClO4/c1-21(2)11-15(25)19-17(13-7-5-6-8-14(13)24)18-16(28-23(19,27)12-21)9-10-22(3,4)20(18)26/h5-8,17,19,27H,9-12H2,1-4H3 |
| InChIKey | KTUZKICMWAOFEM-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.92 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |