C21H23ClN8O3S — CID 24847784
4-amino-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide;3-phenyldiazenylpyridine-2,6-diamine;hydrochloride (PubChem CID 24847784) has the molecular formula C21H23ClN8O3S and a molecular weight of 502.99 g/mol. Its IUPAC name is 4-amino-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide;3-phenyldiazenylpyridine-2,6-diamine;hydrochloride.
| Compound Name | 4-amino-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide;3-phenyldiazenylpyridine-2,6-diamine;hydrochloride |
|---|---|
| PubChem CID | 24847784 |
| Molecular Formula | C21H23ClN8O3S |
| Molecular Weight | 502.99 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | 4-amino-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide;3-phenyldiazenylpyridine-2,6-diamine;hydrochloride |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(N)cc2)no1.Cl.Nc1ccc(/N=N/c2ccccc2)c(N)n1 |
| InChI | InChI=1S/C11H11N5.C10H11N3O3S.ClH/c12-10-7-6-9(11(13)14-10)16-15-8-4-2-1-3-5-8;1-7-6-10(12-16-7)13-17(14,15)9-4-2-8(11)3-5-9;/h1-7H,(H4,12,13,14);2-6H,11H2,1H3,(H,12,13);1H/b16-15+;; |
| InChIKey | LZFPZKIWVFOTQE-VRZXRVJBSA-N |
| XLogP | 4.45 |
| TPSA | 187.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.99 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|