About 1-[(1-aminocyclohexa-2,4-dien-1-yl)methyl]cyclohexa-2,4-dien-1-amine
1-[(1-aminocyclohexa-2,4-dien-1-yl)methyl]cyclohexa-2,4-dien-1-amine (PubChem CID 24848468) has the molecular formula C13H18N2
and a molecular weight of 202.30 g/mol. Its IUPAC name is 1-[(1-aminocyclohexa-2,4-dien-1-yl)methyl]cyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 1-[(1-aminocyclohexa-2,4-dien-1-yl)methyl]cyclohexa-2,4-dien-1-amine |
| PubChem CID | 24848468 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 1-[(1-aminocyclohexa-2,4-dien-1-yl)methyl]cyclohexa-2,4-dien-1-amine |
| SMILES | NC1(CC2(N)C=CC=CC2)C=CC=CC1 |
| InChI | InChI=1S/C13H18N2/c14-12(7-3-1-4-8-12)11-13(15)9-5-2-6-10-13/h1-7,9H,8,10-11,14-15H2 |
| InChIKey | PAAGKQBDVQRQSQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(1-aminocyclohexa-2,4-dien-1-yl)methyl]cyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1-aminocyclohexa-2,4-dien-1-yl)methyl]cyclohexa-2,4-dien-1-amine?
The IUPAC name of 1-[(1-aminocyclohexa-2,4-dien-1-yl)methyl]cyclohexa-2,4-dien-1-amine (CID 24848468) is 1-[(1-aminocyclohexa-2,4-dien-1-yl)methyl]cyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 1-[(1-aminocyclohexa-2,4-dien-1-yl)methyl]cyclohexa-2,4-dien-1-amine?
The canonical SMILES for 1-[(1-aminocyclohexa-2,4-dien-1-yl)methyl]cyclohexa-2,4-dien-1-amine is NC1(CC2(N)C=CC=CC2)C=CC=CC1.
What is the InChIKey of 1-[(1-aminocyclohexa-2,4-dien-1-yl)methyl]cyclohexa-2,4-dien-1-amine?
The InChIKey is PAAGKQBDVQRQSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2/c14-12(7-3-1-4-8-12)11-13(15)9-5-2-6-10-13/h1-7,9H,8,10-11,14-15H2.
What are the key properties of 1-[(1-aminocyclohexa-2,4-dien-1-yl)methyl]cyclohexa-2,4-dien-1-amine?
1-[(1-aminocyclohexa-2,4-dien-1-yl)methyl]cyclohexa-2,4-dien-1-amine has a molecular weight of 202.30 g/mol, XLogP of 1.80, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1-aminocyclohexa-2,4-dien-1-yl)methyl]cyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 24848468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).