About 5-[(3,4-dibromothiophen-2-yl)methyl]-1H-imidazole;hydrochloride
5-[(3,4-dibromothiophen-2-yl)methyl]-1H-imidazole;hydrochloride (PubChem CID 24848624) has the molecular formula C8H7Br2ClN2S
and a molecular weight of 358.49 g/mol. Its IUPAC name is 5-[(3,4-dibromothiophen-2-yl)methyl]-1H-imidazole;hydrochloride.
Molecular Properties
| Compound Name | 5-[(3,4-dibromothiophen-2-yl)methyl]-1H-imidazole;hydrochloride |
| PubChem CID | 24848624 |
| Molecular Formula | C8H7Br2ClN2S |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 355.84 |
| IUPAC Name | 5-[(3,4-dibromothiophen-2-yl)methyl]-1H-imidazole;hydrochloride |
| SMILES | Brc1csc(Cc2cnc[nH]2)c1Br.Cl |
| InChI | InChI=1S/C8H6Br2N2S.ClH/c9-6-3-13-7(8(6)10)1-5-2-11-4-12-5;/h2-4H,1H2,(H,11,12);1H |
| InChIKey | XNMBACTYPDPZEE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(3,4-dibromothiophen-2-yl)methyl]-1H-imidazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,4-dibromothiophen-2-yl)methyl]-1H-imidazole;hydrochloride?
The IUPAC name of 5-[(3,4-dibromothiophen-2-yl)methyl]-1H-imidazole;hydrochloride (CID 24848624) is 5-[(3,4-dibromothiophen-2-yl)methyl]-1H-imidazole;hydrochloride.
What is the SMILES notation for 5-[(3,4-dibromothiophen-2-yl)methyl]-1H-imidazole;hydrochloride?
The canonical SMILES for 5-[(3,4-dibromothiophen-2-yl)methyl]-1H-imidazole;hydrochloride is Brc1csc(Cc2cnc[nH]2)c1Br.Cl.
What is the InChIKey of 5-[(3,4-dibromothiophen-2-yl)methyl]-1H-imidazole;hydrochloride?
The InChIKey is XNMBACTYPDPZEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Br2N2S.ClH/c9-6-3-13-7(8(6)10)1-5-2-11-4-12-5;/h2-4H,1H2,(H,11,12);1H.
What are the key properties of 5-[(3,4-dibromothiophen-2-yl)methyl]-1H-imidazole;hydrochloride?
5-[(3,4-dibromothiophen-2-yl)methyl]-1H-imidazole;hydrochloride has a molecular weight of 358.49 g/mol, XLogP of 4.01, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,4-dibromothiophen-2-yl)methyl]-1H-imidazole;hydrochloride is sourced from PubChem (CID 24848624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).