C26H32N4O2 — CID 24848780
1-[2-(2-butyl-1,3-dimethyl-4,6-dioxopyrrolo[3,4-c]pyrrol-5-yl)ethyl]-4-phenylpiperidine-4-carbonitrile (PubChem CID 24848780) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 1-[2-(2-butyl-1,3-dimethyl-4,6-dioxopyrrolo[3,4-c]pyrrol-5-yl)ethyl]-4-phenylpiperidine-4-carbonitrile.
| Compound Name | 1-[2-(2-butyl-1,3-dimethyl-4,6-dioxopyrrolo[3,4-c]pyrrol-5-yl)ethyl]-4-phenylpiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 24848780 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 1-[2-(2-butyl-1,3-dimethyl-4,6-dioxopyrrolo[3,4-c]pyrrol-5-yl)ethyl]-4-phenylpiperidine-4-carbonitrile |
| SMILES | CCCCn1c(C)c2c(c1C)C(=O)N(CCN1CCC(C#N)(c3ccccc3)CC1)C2=O |
| InChI | InChI=1S/C26H32N4O2/c1-4-5-13-29-19(2)22-23(20(29)3)25(32)30(24(22)31)17-16-28-14-11-26(18-27,12-15-28)21-9-7-6-8-10-21/h6-10H,4-5,11-17H2,1-3H3 |
| InChIKey | WUSYCZRASGBFMY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 69.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|