About CID 24848861
CID 24848861 (PubChem CID 24848861) has the molecular formula C6H6CaN6O6
and a molecular weight of 298.23 g/mol.
Molecular Properties
| Compound Name | CID 24848861 |
| PubChem CID | 24848861 |
| Molecular Formula | C6H6CaN6O6 |
| Molecular Weight | 298.23 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | — |
| SMILES | O=c1[nH]c(=O)[nH]c(=O)[nH]1.O=c1[nH]c(=O)[nH]c(=O)[nH]1.[Ca] |
| InChI | InChI=1S/2C3H3N3O3.Ca/c2*7-1-4-2(8)6-3(9)5-1;/h2*(H3,4,5,6,7,8,9); |
| InChIKey | VMUJEKDONXJDSN-UHFFFAOYSA-N |
| XLogP | -4.88 |
| TPSA | 197.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.23 |
| LogP ≤ 5 | -4.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 24848861 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 24848861?
The IUPAC name of CID 24848861 (CID 24848861) is not available.
What is the SMILES notation for CID 24848861?
The canonical SMILES for CID 24848861 is O=c1[nH]c(=O)[nH]c(=O)[nH]1.O=c1[nH]c(=O)[nH]c(=O)[nH]1.[Ca].
What is the InChIKey of CID 24848861?
The InChIKey is VMUJEKDONXJDSN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C3H3N3O3.Ca/c2*7-1-4-2(8)6-3(9)5-1;/h2*(H3,4,5,6,7,8,9);.
What are the key properties of CID 24848861?
CID 24848861 has a molecular weight of 298.23 g/mol, XLogP of -4.88, 0 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 24848861 is sourced from PubChem (CID 24848861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).