About 3-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-4-methylbenzamide
3-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-4-methylbenzamide (PubChem CID 24848935) has the molecular formula C18H18Cl2N2O2
and a molecular weight of 365.26 g/mol. Its IUPAC name is 3-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-4-methylbenzamide.
Molecular Properties
| Compound Name | 3-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-4-methylbenzamide |
| PubChem CID | 24848935 |
| Molecular Formula | C18H18Cl2N2O2 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 3-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2c(Cl)cncc2Cl)cc1OC1CCCC1 |
| InChI | InChI=1S/C18H18Cl2N2O2/c1-11-6-7-12(8-16(11)24-13-4-2-3-5-13)18(23)22-17-14(19)9-21-10-15(17)20/h6-10,13H,2-5H2,1H3,(H,21,22,23) |
| InChIKey | KTOUPOVYOXEPEW-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-4-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-4-methylbenzamide?
The IUPAC name of 3-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-4-methylbenzamide (CID 24848935) is 3-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-4-methylbenzamide.
What is the SMILES notation for 3-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-4-methylbenzamide?
The canonical SMILES for 3-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-4-methylbenzamide is Cc1ccc(C(=O)Nc2c(Cl)cncc2Cl)cc1OC1CCCC1.
What is the InChIKey of 3-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-4-methylbenzamide?
The InChIKey is KTOUPOVYOXEPEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18Cl2N2O2/c1-11-6-7-12(8-16(11)24-13-4-2-3-5-13)18(23)22-17-14(19)9-21-10-15(17)20/h6-10,13H,2-5H2,1H3,(H,21,22,23).
What are the key properties of 3-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-4-methylbenzamide?
3-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-4-methylbenzamide has a molecular weight of 365.26 g/mol, XLogP of 5.27, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-4-methylbenzamide is sourced from PubChem (CID 24848935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).